| Name | Adenine hydrochloride |
| Synonyms | Adenine HCL ADENINIUM CHLORIDE Adenine hydrochloride ADENINE HYDROCHLORIDE 1H-Adenine hydrochloride 1H-adenine hydrochloride ADENINE MONOHYDROCHLORIDE 1H-Purin-6-amine, hydrochloride Adenine hydrochloride anhydrous 1H-Purin-6-amine monohydrochloride 1H-Purin-6-amine, monohydrochloride 6-Aminopurine hydrochloride anhydrous |
| CAS | 2922-28-3 |
| EINECS | 220-867-0 |
| InChI | InChI=1/C5H5N5.ClH/c6-4-3-5(9-1-7-3)10-2-8-4;/h1-2H,(H3,6,7,8,9,10);1H |
| Molecular Formula | C5H6ClN5 |
| Molar Mass | 171.59 |
| Melting Point | ~285°C (dec.) |
| Solubility | H2O: 50mg/mL |
| Appearance | powder |
| Color | White to Off-White |
| Merck | 14,152 |
| BRN | 4009585 |
| Storage Condition | Inert atmosphere,Room Temperature |
| Sensitive | Sensitive to light |
| MDL | MFCD00075782 |
| Use | Microbial method for the determination of niacin. Biochemical research. |
| Risk Codes | R22 - Harmful if swallowed R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 3-8 |
| TSCA | Yes |
| HS Code | 29335990 |